C18H27ClIN7O — CID 111917514
1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111917514) has the molecular formula C18H27ClIN7O and a molecular weight of 519.82 g/mol. Its IUPAC name is 1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111917514 |
| Molecular Formula | C18H27ClIN7O |
| Molecular Weight | 519.82 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | 1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCn1cnnc1CN/C(=N\C)NC1CCN(c2cc(Cl)ccc2OC)C1.I |
| InChI | InChI=1S/C18H26ClN7O.HI/c1-4-25-12-22-24-17(25)10-21-18(20-2)23-14-7-8-26(11-14)15-9-13(19)5-6-16(15)27-3;/h5-6,9,12,14H,4,7-8,10-11H2,1-3H3,(H2,20,21,23);1H |
| InChIKey | YJWJYAGTIMASMY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.82 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|