C20H32ClN5O — CID 111917315
1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-3-[2-cyclopropyl-2-(dimethylamino)ethyl]-2-methylguanidine (PubChem CID 111917315) has the molecular formula C20H32ClN5O and a molecular weight of 393.96 g/mol. Its IUPAC name is 1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-3-[2-cyclopropyl-2-(dimethylamino)ethyl]-2-methylguanidine.
| Compound Name | 1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-3-[2-cyclopropyl-2-(dimethylamino)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111917315 |
| Molecular Formula | C20H32ClN5O |
| Molecular Weight | 393.96 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-3-[2-cyclopropyl-2-(dimethylamino)ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCC(C1CC1)N(C)C)NC1CCN(c2cc(Cl)ccc2OC)C1 |
| InChI | InChI=1S/C20H32ClN5O/c1-22-20(23-12-18(25(2)3)14-5-6-14)24-16-9-10-26(13-16)17-11-15(21)7-8-19(17)27-4/h7-8,11,14,16,18H,5-6,9-10,12-13H2,1-4H3,(H2,22,23,24) |
| InChIKey | ZMYVCQGRRZMWNX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.96 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|