C19H29ClN4O3 — CID 111916921
propan-2-yl 3-[[N-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]propanoate (PubChem CID 111916921) has the molecular formula C19H29ClN4O3 and a molecular weight of 396.92 g/mol. Its IUPAC name is propan-2-yl 3-[[N-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]propanoate.
| Compound Name | propan-2-yl 3-[[N-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]propanoate |
|---|---|
| PubChem CID | 111916921 |
| Molecular Formula | C19H29ClN4O3 |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | propan-2-yl 3-[[N-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]propanoate |
| SMILES | C/N=C(\NCCC(=O)OC(C)C)NC1CCN(c2cc(Cl)ccc2OC)C1 |
| InChI | InChI=1S/C19H29ClN4O3/c1-13(2)27-18(25)7-9-22-19(21-3)23-15-8-10-24(12-15)16-11-14(20)5-6-17(16)26-4/h5-6,11,13,15H,7-10,12H2,1-4H3,(H2,21,22,23) |
| InChIKey | WPDBBWCETIZQNP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|