C22H28ClN5O2 — CID 111916943
N-[2-[[N-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]ethyl]benzamide (PubChem CID 111916943) has the molecular formula C22H28ClN5O2 and a molecular weight of 429.95 g/mol. Its IUPAC name is N-[2-[[N-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]ethyl]benzamide.
| Compound Name | N-[2-[[N-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111916943 |
| Molecular Formula | C22H28ClN5O2 |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | N-[2-[[N-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]ethyl]benzamide |
| SMILES | C/N=C(\NCCNC(=O)c1ccccc1)NC1CCN(c2cc(Cl)ccc2OC)C1 |
| InChI | InChI=1S/C22H28ClN5O2/c1-24-22(26-12-11-25-21(29)16-6-4-3-5-7-16)27-18-10-13-28(15-18)19-14-17(23)8-9-20(19)30-2/h3-9,14,18H,10-13,15H2,1-2H3,(H,25,29)(H2,24,26,27) |
| InChIKey | KLLCWRAOOBKZHF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|