C19H29ClN4OS — CID 119158461
1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-2-methyl-3-(thian-4-ylmethyl)guanidine (PubChem CID 119158461) has the molecular formula C19H29ClN4OS and a molecular weight of 396.99 g/mol. Its IUPAC name is 1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-2-methyl-3-(thian-4-ylmethyl)guanidine.
| Compound Name | 1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-2-methyl-3-(thian-4-ylmethyl)guanidine |
|---|---|
| PubChem CID | 119158461 |
| Molecular Formula | C19H29ClN4OS |
| Molecular Weight | 396.99 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-2-methyl-3-(thian-4-ylmethyl)guanidine |
| SMILES | C/N=C(\NCC1CCSCC1)NC1CCN(c2cc(Cl)ccc2OC)C1 |
| InChI | InChI=1S/C19H29ClN4OS/c1-21-19(22-12-14-6-9-26-10-7-14)23-16-5-8-24(13-16)17-11-15(20)3-4-18(17)25-2/h3-4,11,14,16H,5-10,12-13H2,1-2H3,(H2,21,22,23) |
| InChIKey | PDKBZLQSOLACGQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.99 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|