C17H26ClN5O2 — CID 119150404
2-[[N-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylacetamide (PubChem CID 119150404) has the molecular formula C17H26ClN5O2 and a molecular weight of 367.88 g/mol. Its IUPAC name is 2-[[N-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[N-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 119150404 |
| Molecular Formula | C17H26ClN5O2 |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 2-[[N-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylacetamide |
| SMILES | C/N=C(\NCC(=O)N(C)C)NC1CCN(c2cc(Cl)ccc2OC)C1 |
| InChI | InChI=1S/C17H26ClN5O2/c1-19-17(20-10-16(24)22(2)3)21-13-7-8-23(11-13)14-9-12(18)5-6-15(14)25-4/h5-6,9,13H,7-8,10-11H2,1-4H3,(H2,19,20,21) |
| InChIKey | SNJYAXKKIBWMAI-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|