C15H24ClIN4O — CID 111917398
3-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-1,1,2-trimethylguanidine;hydroiodide (PubChem CID 111917398) has the molecular formula C15H24ClIN4O and a molecular weight of 438.74 g/mol. Its IUPAC name is 3-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-1,1,2-trimethylguanidine;hydroiodide.
| Compound Name | 3-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-1,1,2-trimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111917398 |
| Molecular Formula | C15H24ClIN4O |
| Molecular Weight | 438.74 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | 3-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-1,1,2-trimethylguanidine;hydroiodide |
| SMILES | C/N=C(/NC1CCN(c2cc(Cl)ccc2OC)C1)N(C)C.I |
| InChI | InChI=1S/C15H23ClN4O.HI/c1-17-15(19(2)3)18-12-7-8-20(10-12)13-9-11(16)5-6-14(13)21-4;/h5-6,9,12H,7-8,10H2,1-4H3,(H,17,18);1H |
| InChIKey | WRLKZLZAKZCOBV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.74 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|