C20H32ClN5O2 — CID 111917561
N-[2-[[[[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]ethyl]-2-methylpropanamide (PubChem CID 111917561) has the molecular formula C20H32ClN5O2 and a molecular weight of 409.96 g/mol. Its IUPAC name is N-[2-[[[[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]ethyl]-2-methylpropanamide.
| Compound Name | N-[2-[[[[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]ethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 111917561 |
| Molecular Formula | C20H32ClN5O2 |
| Molecular Weight | 409.96 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | N-[2-[[[[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]ethyl]-2-methylpropanamide |
| SMILES | CCN/C(=N\CCNC(=O)C(C)C)NC1CCN(c2cc(Cl)ccc2OC)C1 |
| InChI | InChI=1S/C20H32ClN5O2/c1-5-22-20(24-10-9-23-19(27)14(2)3)25-16-8-11-26(13-16)17-12-15(21)6-7-18(17)28-4/h6-7,12,14,16H,5,8-11,13H2,1-4H3,(H,23,27)(H2,22,24,25) |
| InChIKey | RLCHLEZCBLFVCX-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.96 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|