C21H28ClN5O3 — CID 111917467
N-[2-[[[[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]ethyl]furan-2-carboxamide (PubChem CID 111917467) has the molecular formula C21H28ClN5O3 and a molecular weight of 433.94 g/mol. Its IUPAC name is N-[2-[[[[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[[[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 111917467 |
| Molecular Formula | C21H28ClN5O3 |
| Molecular Weight | 433.94 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | N-[2-[[[[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]ethyl]furan-2-carboxamide |
| SMILES | CCN/C(=N\CCNC(=O)c1ccco1)NC1CCN(c2cc(Cl)ccc2OC)C1 |
| InChI | InChI=1S/C21H28ClN5O3/c1-3-23-21(25-10-9-24-20(28)19-5-4-12-30-19)26-16-8-11-27(14-16)17-13-15(22)6-7-18(17)29-2/h4-7,12-13,16H,3,8-11,14H2,1-2H3,(H,24,28)(H2,23,25,26) |
| InChIKey | BBFOBFWDQKLZLO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.94 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|