C18H30ClIN4O3S — CID 111917468
1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-3-ethyl-2-(3-methylsulfonylpropyl)guanidine;hydroiodide (PubChem CID 111917468) has the molecular formula C18H30ClIN4O3S and a molecular weight of 544.89 g/mol. Its IUPAC name is 1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-3-ethyl-2-(3-methylsulfonylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-3-ethyl-2-(3-methylsulfonylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111917468 |
| Molecular Formula | C18H30ClIN4O3S |
| Molecular Weight | 544.89 g/mol |
| Exact Mass | 544.08 |
| IUPAC Name | 1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-3-ethyl-2-(3-methylsulfonylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCS(C)(=O)=O)NC1CCN(c2cc(Cl)ccc2OC)C1.I |
| InChI | InChI=1S/C18H29ClN4O3S.HI/c1-4-20-18(21-9-5-11-27(3,24)25)22-15-8-10-23(13-15)16-12-14(19)6-7-17(16)26-2;/h6-7,12,15H,4-5,8-11,13H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | QSROYXIJYDXIQG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.89 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|