C17H28ClIN4O2S — CID 109463427
1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-ethyl-2-(3-methylsulfonylpropyl)guanidine;hydroiodide (PubChem CID 109463427) has the molecular formula C17H28ClIN4O2S and a molecular weight of 514.86 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-ethyl-2-(3-methylsulfonylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-ethyl-2-(3-methylsulfonylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109463427 |
| Molecular Formula | C17H28ClIN4O2S |
| Molecular Weight | 514.86 g/mol |
| Exact Mass | 514.07 |
| IUPAC Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-ethyl-2-(3-methylsulfonylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCS(C)(=O)=O)NC1CCN(c2cccc(Cl)c2)C1.I |
| InChI | InChI=1S/C17H27ClN4O2S.HI/c1-3-19-17(20-9-5-11-25(2,23)24)21-15-8-10-22(13-15)16-7-4-6-14(18)12-16;/h4,6-7,12,15H,3,5,8-11,13H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | NBCRQSGAXOLUJF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.86 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|