C20H34ClN5O2 — CID 111917369
1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-3-ethyl-2-[2-[2-methoxyethyl(methyl)amino]ethyl]guanidine (PubChem CID 111917369) has the molecular formula C20H34ClN5O2 and a molecular weight of 411.98 g/mol. Its IUPAC name is 1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-3-ethyl-2-[2-[2-methoxyethyl(methyl)amino]ethyl]guanidine.
| Compound Name | 1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-3-ethyl-2-[2-[2-methoxyethyl(methyl)amino]ethyl]guanidine |
|---|---|
| PubChem CID | 111917369 |
| Molecular Formula | C20H34ClN5O2 |
| Molecular Weight | 411.98 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-3-ethyl-2-[2-[2-methoxyethyl(methyl)amino]ethyl]guanidine |
| SMILES | CCN/C(=N\CCN(C)CCOC)NC1CCN(c2cc(Cl)ccc2OC)C1 |
| InChI | InChI=1S/C20H34ClN5O2/c1-5-22-20(23-9-11-25(2)12-13-27-3)24-17-8-10-26(15-17)18-14-16(21)6-7-19(18)28-4/h6-7,14,17H,5,8-13,15H2,1-4H3,(H2,22,23,24) |
| InChIKey | XIMHQZUVDSWGMN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.98 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|