C19H32F2IN5O — CID 111920908
1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[2-[2-methoxyethyl(methyl)amino]ethyl]guanidine;hydroiodide (PubChem CID 111920908) has the molecular formula C19H32F2IN5O and a molecular weight of 511.40 g/mol. Its IUPAC name is 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[2-[2-methoxyethyl(methyl)amino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[2-[2-methoxyethyl(methyl)amino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111920908 |
| Molecular Formula | C19H32F2IN5O |
| Molecular Weight | 511.40 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[2-[2-methoxyethyl(methyl)amino]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCN(C)CCOC)NC1CCN(c2ccc(F)cc2F)C1.I |
| InChI | InChI=1S/C19H31F2N5O.HI/c1-4-22-19(23-8-10-25(2)11-12-27-3)24-16-7-9-26(14-16)18-6-5-15(20)13-17(18)21;/h5-6,13,16H,4,7-12,14H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | IEOVCLCKMAEVER-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|