C16H24F2N4O2S — CID 111920797
1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-(2-methylsulfonylethyl)guanidine (PubChem CID 111920797) has the molecular formula C16H24F2N4O2S and a molecular weight of 374.46 g/mol. Its IUPAC name is 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-(2-methylsulfonylethyl)guanidine.
| Compound Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-(2-methylsulfonylethyl)guanidine |
|---|---|
| PubChem CID | 111920797 |
| Molecular Formula | C16H24F2N4O2S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-(2-methylsulfonylethyl)guanidine |
| SMILES | CCN/C(=N\CCS(C)(=O)=O)NC1CCN(c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C16H24F2N4O2S/c1-3-19-16(20-7-9-25(2,23)24)21-13-6-8-22(11-13)15-5-4-12(17)10-14(15)18/h4-5,10,13H,3,6-9,11H2,1-2H3,(H2,19,20,21) |
| InChIKey | OPBVJPNRAIAHTJ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|