C20H32F2N4O2 — CID 111920815
1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[4-(2-methoxyethoxy)butyl]guanidine (PubChem CID 111920815) has the molecular formula C20H32F2N4O2 and a molecular weight of 398.50 g/mol. Its IUPAC name is 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[4-(2-methoxyethoxy)butyl]guanidine.
| Compound Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[4-(2-methoxyethoxy)butyl]guanidine |
|---|---|
| PubChem CID | 111920815 |
| Molecular Formula | C20H32F2N4O2 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[4-(2-methoxyethoxy)butyl]guanidine |
| SMILES | CCN/C(=N\CCCCOCCOC)NC1CCN(c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C20H32F2N4O2/c1-3-23-20(24-9-4-5-11-28-13-12-27-2)25-17-8-10-26(15-17)19-7-6-16(21)14-18(19)22/h6-7,14,17H,3-5,8-13,15H2,1-2H3,(H2,23,24,25) |
| InChIKey | GMFSCIGIJLSUGH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|