C23H29F2IN4O3 — CID 111920800
methyl 5-[[[[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]methyl]-2-methoxybenzoate;hydroiodide (PubChem CID 111920800) has the molecular formula C23H29F2IN4O3 and a molecular weight of 574.41 g/mol. Its IUPAC name is methyl 5-[[[[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]methyl]-2-methoxybenzoate;hydroiodide.
| Compound Name | methyl 5-[[[[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]methyl]-2-methoxybenzoate;hydroiodide |
|---|---|
| PubChem CID | 111920800 |
| Molecular Formula | C23H29F2IN4O3 |
| Molecular Weight | 574.41 g/mol |
| Exact Mass | 574.13 |
| IUPAC Name | methyl 5-[[[[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]methyl]-2-methoxybenzoate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(C(=O)OC)c1)NC1CCN(c2ccc(F)cc2F)C1.I |
| InChI | InChI=1S/C23H28F2N4O3.HI/c1-4-26-23(27-13-15-5-8-21(31-2)18(11-15)22(30)32-3)28-17-9-10-29(14-17)20-7-6-16(24)12-19(20)25;/h5-8,11-12,17H,4,9-10,13-14H2,1-3H3,(H2,26,27,28);1H |
| InChIKey | QTPIDURNQZCLKE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|