C17H21F2N5O — CID 97223485
1-[(3R)-1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-(1,2-oxazol-3-ylmethyl)guanidine (PubChem CID 97223485) has the molecular formula C17H21F2N5O and a molecular weight of 349.39 g/mol. Its IUPAC name is 1-[(3R)-1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-(1,2-oxazol-3-ylmethyl)guanidine.
| Compound Name | 1-[(3R)-1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-(1,2-oxazol-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 97223485 |
| Molecular Formula | C17H21F2N5O |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 1-[(3R)-1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-(1,2-oxazol-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccon1)N[C@@H]1CCN(c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C17H21F2N5O/c1-2-20-17(21-10-13-6-8-25-23-13)22-14-5-7-24(11-14)16-4-3-12(18)9-15(16)19/h3-4,6,8-9,14H,2,5,7,10-11H2,1H3,(H2,20,21,22)/t14-/m1/s1 |
| InChIKey | DQGGTLYMJWXDLN-CQSZACIVSA-N |
| XLogP | 2.29 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|