C21H30F2IN7 — CID 111920670
1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111920670) has the molecular formula C21H30F2IN7 and a molecular weight of 545.42 g/mol. Its IUPAC name is 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111920670 |
| Molecular Formula | C21H30F2IN7 |
| Molecular Weight | 545.42 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nnc2n1CCCCC2)NC1CCN(c2ccc(F)cc2F)C1.I |
| InChI | InChI=1S/C21H29F2N7.HI/c1-2-24-21(25-13-20-28-27-19-6-4-3-5-10-30(19)20)26-16-9-11-29(14-16)18-8-7-15(22)12-17(18)23;/h7-8,12,16H,2-6,9-11,13-14H2,1H3,(H2,24,25,26);1H |
| InChIKey | ZVUPJGYSACXAGW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|