C20H28BrN7 — CID 111917825
1-[1-(4-bromophenyl)pyrrolidin-3-yl]-3-ethyl-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine (PubChem CID 111917825) has the molecular formula C20H28BrN7 and a molecular weight of 446.40 g/mol. Its IUPAC name is 1-[1-(4-bromophenyl)pyrrolidin-3-yl]-3-ethyl-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine.
| Compound Name | 1-[1-(4-bromophenyl)pyrrolidin-3-yl]-3-ethyl-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111917825 |
| Molecular Formula | C20H28BrN7 |
| Molecular Weight | 446.40 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 1-[1-(4-bromophenyl)pyrrolidin-3-yl]-3-ethyl-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1nnc2n1CCCC2)NC1CCN(c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C20H28BrN7/c1-2-22-20(23-13-19-26-25-18-5-3-4-11-28(18)19)24-16-10-12-27(14-16)17-8-6-15(21)7-9-17/h6-9,16H,2-5,10-14H2,1H3,(H2,22,23,24) |
| InChIKey | ZNDHQCMFKMEYJS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|