C20H26BrN5O — CID 111917821
1-[1-(4-bromophenyl)pyrrolidin-3-yl]-3-ethyl-2-[(6-methoxy-3-pyridinyl)methyl]guanidine (PubChem CID 111917821) has the molecular formula C20H26BrN5O and a molecular weight of 432.37 g/mol. Its IUPAC name is 1-[1-(4-bromophenyl)pyrrolidin-3-yl]-3-ethyl-2-[(6-methoxy-3-pyridinyl)methyl]guanidine.
| Compound Name | 1-[1-(4-bromophenyl)pyrrolidin-3-yl]-3-ethyl-2-[(6-methoxy-3-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 111917821 |
| Molecular Formula | C20H26BrN5O |
| Molecular Weight | 432.37 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 1-[1-(4-bromophenyl)pyrrolidin-3-yl]-3-ethyl-2-[(6-methoxy-3-pyridinyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(OC)nc1)NC1CCN(c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C20H26BrN5O/c1-3-22-20(24-13-15-4-9-19(27-2)23-12-15)25-17-10-11-26(14-17)18-7-5-16(21)6-8-18/h4-9,12,17H,3,10-11,13-14H2,1-2H3,(H2,22,24,25) |
| InChIKey | VDBILYOTGBUWSE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|