C20H31BrN4O2 — CID 111917815
methyl 6-[[[[1-(4-bromophenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]hexanoate (PubChem CID 111917815) has the molecular formula C20H31BrN4O2 and a molecular weight of 439.40 g/mol. Its IUPAC name is methyl 6-[[[[1-(4-bromophenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]hexanoate.
| Compound Name | methyl 6-[[[[1-(4-bromophenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]hexanoate |
|---|---|
| PubChem CID | 111917815 |
| Molecular Formula | C20H31BrN4O2 |
| Molecular Weight | 439.40 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | methyl 6-[[[[1-(4-bromophenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]hexanoate |
| SMILES | CCN/C(=N\CCCCCC(=O)OC)NC1CCN(c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C20H31BrN4O2/c1-3-22-20(23-13-6-4-5-7-19(26)27-2)24-17-12-14-25(15-17)18-10-8-16(21)9-11-18/h8-11,17H,3-7,12-15H2,1-2H3,(H2,22,23,24) |
| InChIKey | QPCIEHDNRKTCNX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|