C19H28BrIN6 — CID 111917830
1-[1-(4-bromophenyl)pyrrolidin-3-yl]-3-ethyl-2-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide (PubChem CID 111917830) has the molecular formula C19H28BrIN6 and a molecular weight of 547.28 g/mol. Its IUPAC name is 1-[1-(4-bromophenyl)pyrrolidin-3-yl]-3-ethyl-2-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[1-(4-bromophenyl)pyrrolidin-3-yl]-3-ethyl-2-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111917830 |
| Molecular Formula | C19H28BrIN6 |
| Molecular Weight | 547.28 g/mol |
| Exact Mass | 546.06 |
| IUPAC Name | 1-[1-(4-bromophenyl)pyrrolidin-3-yl]-3-ethyl-2-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCn1cccn1)NC1CCN(c2ccc(Br)cc2)C1.I |
| InChI | InChI=1S/C19H27BrN6.HI/c1-2-21-19(22-10-3-12-26-13-4-11-23-26)24-17-9-14-25(15-17)18-7-5-16(20)6-8-18;/h4-8,11,13,17H,2-3,9-10,12,14-15H2,1H3,(H2,21,22,24);1H |
| InChIKey | NUPZVTYSCQEJIJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.28 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|