C20H27BrIN5O — CID 111917874
1-[1-(4-bromophenyl)pyrrolidin-3-yl]-3-ethyl-2-[(2-methoxy-4-pyridinyl)methyl]guanidine;hydroiodide (PubChem CID 111917874) has the molecular formula C20H27BrIN5O and a molecular weight of 560.28 g/mol. Its IUPAC name is 1-[1-(4-bromophenyl)pyrrolidin-3-yl]-3-ethyl-2-[(2-methoxy-4-pyridinyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(4-bromophenyl)pyrrolidin-3-yl]-3-ethyl-2-[(2-methoxy-4-pyridinyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111917874 |
| Molecular Formula | C20H27BrIN5O |
| Molecular Weight | 560.28 g/mol |
| Exact Mass | 559.04 |
| IUPAC Name | 1-[1-(4-bromophenyl)pyrrolidin-3-yl]-3-ethyl-2-[(2-methoxy-4-pyridinyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccnc(OC)c1)NC1CCN(c2ccc(Br)cc2)C1.I |
| InChI | InChI=1S/C20H26BrN5O.HI/c1-3-22-20(24-13-15-8-10-23-19(12-15)27-2)25-17-9-11-26(14-17)18-6-4-16(21)5-7-18;/h4-8,10,12,17H,3,9,11,13-14H2,1-2H3,(H2,22,24,25);1H |
| InChIKey | BGUCVPRSFHYCAK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.28 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|