C22H35F2IN4O3 — CID 111921438
methyl 7-[[[[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]heptanoate;hydroiodide (PubChem CID 111921438) has the molecular formula C22H35F2IN4O3 and a molecular weight of 568.45 g/mol. Its IUPAC name is methyl 7-[[[[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]heptanoate;hydroiodide.
| Compound Name | methyl 7-[[[[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]heptanoate;hydroiodide |
|---|---|
| PubChem CID | 111921438 |
| Molecular Formula | C22H35F2IN4O3 |
| Molecular Weight | 568.45 g/mol |
| Exact Mass | 568.17 |
| IUPAC Name | methyl 7-[[[[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]heptanoate;hydroiodide |
| SMILES | CCN/C(=N\CCCCCCC(=O)OC)NC1CCN(c2ccccc2OC(F)F)C1.I |
| InChI | InChI=1S/C22H34F2N4O3.HI/c1-3-25-22(26-14-9-5-4-6-12-20(29)30-2)27-17-13-15-28(16-17)18-10-7-8-11-19(18)31-21(23)24;/h7-8,10-11,17,21H,3-6,9,12-16H2,1-2H3,(H2,25,26,27);1H |
| InChIKey | HIXIMRFWKZGVQA-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|