C22H33F2N5O2 — CID 111921655
N-cyclohexyl-2-[[[[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]acetamide (PubChem CID 111921655) has the molecular formula C22H33F2N5O2 and a molecular weight of 437.54 g/mol. Its IUPAC name is N-cyclohexyl-2-[[[[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]acetamide.
| Compound Name | N-cyclohexyl-2-[[[[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111921655 |
| Molecular Formula | C22H33F2N5O2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | N-cyclohexyl-2-[[[[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]acetamide |
| SMILES | CCN/C(=N\CC(=O)NC1CCCCC1)NC1CCN(c2ccccc2OC(F)F)C1 |
| InChI | InChI=1S/C22H33F2N5O2/c1-2-25-22(26-14-20(30)27-16-8-4-3-5-9-16)28-17-12-13-29(15-17)18-10-6-7-11-19(18)31-21(23)24/h6-7,10-11,16-17,21H,2-5,8-9,12-15H2,1H3,(H,27,30)(H2,25,26,28) |
| InChIKey | XLFQPCBCURUEGB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|