C21H25F2N5O3 — CID 111921663
1-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-3-ethyl-2-[(2-nitrophenyl)methyl]guanidine (PubChem CID 111921663) has the molecular formula C21H25F2N5O3 and a molecular weight of 433.46 g/mol. Its IUPAC name is 1-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-3-ethyl-2-[(2-nitrophenyl)methyl]guanidine.
| Compound Name | 1-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-3-ethyl-2-[(2-nitrophenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111921663 |
| Molecular Formula | C21H25F2N5O3 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 1-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-3-ethyl-2-[(2-nitrophenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccccc1[N+](=O)[O-])NC1CCN(c2ccccc2OC(F)F)C1 |
| InChI | InChI=1S/C21H25F2N5O3/c1-2-24-21(25-13-15-7-3-4-8-17(15)28(29)30)26-16-11-12-27(14-16)18-9-5-6-10-19(18)31-20(22)23/h3-10,16,20H,2,11-14H2,1H3,(H2,24,25,26) |
| InChIKey | NWCHXUBPBYWBCI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 92.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|