C22H28F2N4O2 — CID 111921791
1-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-3-ethyl-2-[(2-methoxyphenyl)methyl]guanidine (PubChem CID 111921791) has the molecular formula C22H28F2N4O2 and a molecular weight of 418.49 g/mol. Its IUPAC name is 1-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-3-ethyl-2-[(2-methoxyphenyl)methyl]guanidine.
| Compound Name | 1-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-3-ethyl-2-[(2-methoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111921791 |
| Molecular Formula | C22H28F2N4O2 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 1-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-3-ethyl-2-[(2-methoxyphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccccc1OC)NC1CCN(c2ccccc2OC(F)F)C1 |
| InChI | InChI=1S/C22H28F2N4O2/c1-3-25-22(26-14-16-8-4-6-10-19(16)29-2)27-17-12-13-28(15-17)18-9-5-7-11-20(18)30-21(23)24/h4-11,17,21H,3,12-15H2,1-2H3,(H2,25,26,27) |
| InChIKey | JNEQNXNABNLSIX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|