C20H30F2N4O2 — CID 111920537
methyl 6-[[[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]hexanoate (PubChem CID 111920537) has the molecular formula C20H30F2N4O2 and a molecular weight of 396.48 g/mol. Its IUPAC name is methyl 6-[[[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]hexanoate.
| Compound Name | methyl 6-[[[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]hexanoate |
|---|---|
| PubChem CID | 111920537 |
| Molecular Formula | C20H30F2N4O2 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | methyl 6-[[[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]hexanoate |
| SMILES | CCN/C(=N\CCCCCC(=O)OC)NC1CCN(c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C20H30F2N4O2/c1-3-23-20(24-11-6-4-5-7-19(27)28-2)25-16-10-12-26(14-16)18-9-8-15(21)13-17(18)22/h8-9,13,16H,3-7,10-12,14H2,1-2H3,(H2,23,24,25) |
| InChIKey | CIFLZYGNRMNSPR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|