C21H34N4O4 — CID 111925155
methyl 5-[[[[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]pentanoate (PubChem CID 111925155) has the molecular formula C21H34N4O4 and a molecular weight of 406.53 g/mol. Its IUPAC name is methyl 5-[[[[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]pentanoate.
| Compound Name | methyl 5-[[[[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]pentanoate |
|---|---|
| PubChem CID | 111925155 |
| Molecular Formula | C21H34N4O4 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | methyl 5-[[[[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]pentanoate |
| SMILES | CCN/C(=N\CCCCC(=O)OC)NC1CCN(c2cc(OC)cc(OC)c2)C1 |
| InChI | InChI=1S/C21H34N4O4/c1-5-22-21(23-10-7-6-8-20(26)29-4)24-16-9-11-25(15-16)17-12-18(27-2)14-19(13-17)28-3/h12-14,16H,5-11,15H2,1-4H3,(H2,22,23,24) |
| InChIKey | GXIFZABMFBFYEG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|