C22H38IN5O3 — CID 111924876
N-butan-2-yl-3-[[[[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]propanamide;hydroiodide (PubChem CID 111924876) has the molecular formula C22H38IN5O3 and a molecular weight of 547.48 g/mol. Its IUPAC name is N-butan-2-yl-3-[[[[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]propanamide;hydroiodide.
| Compound Name | N-butan-2-yl-3-[[[[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111924876 |
| Molecular Formula | C22H38IN5O3 |
| Molecular Weight | 547.48 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | N-butan-2-yl-3-[[[[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]propanamide;hydroiodide |
| SMILES | CCN/C(=N\CCC(=O)NC(C)CC)NC1CCN(c2cc(OC)cc(OC)c2)C1.I |
| InChI | InChI=1S/C22H37N5O3.HI/c1-6-16(3)25-21(28)8-10-24-22(23-7-2)26-17-9-11-27(15-17)18-12-19(29-4)14-20(13-18)30-5;/h12-14,16-17H,6-11,15H2,1-5H3,(H,25,28)(H2,23,24,26);1H |
| InChIKey | TVCZFEGKVIKTKC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|