C18H26F2IN5O — CID 111921054
N-cyclopropyl-2-[[[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 111921054) has the molecular formula C18H26F2IN5O and a molecular weight of 493.34 g/mol. Its IUPAC name is N-cyclopropyl-2-[[[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N-cyclopropyl-2-[[[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111921054 |
| Molecular Formula | C18H26F2IN5O |
| Molecular Weight | 493.34 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | N-cyclopropyl-2-[[[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)NC1CC1)NC1CCN(c2ccc(F)cc2F)C1.I |
| InChI | InChI=1S/C18H25F2N5O.HI/c1-2-21-18(22-10-17(26)23-13-4-5-13)24-14-7-8-25(11-14)16-6-3-12(19)9-15(16)20;/h3,6,9,13-14H,2,4-5,7-8,10-11H2,1H3,(H,23,26)(H2,21,22,24);1H |
| InChIKey | WGRSSLFPXXJXJH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|