C18H25F2N7 — CID 111921273
1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 111921273) has the molecular formula C18H25F2N7 and a molecular weight of 377.44 g/mol. Its IUPAC name is 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111921273 |
| Molecular Formula | C18H25F2N7 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1nncn1CC)NC1CCN(c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C18H25F2N7/c1-3-21-18(22-10-17-25-23-12-26(17)4-2)24-14-7-8-27(11-14)16-6-5-13(19)9-15(16)20/h5-6,9,12,14H,3-4,7-8,10-11H2,1-2H3,(H2,21,22,24) |
| InChIKey | LIYHIDBVKYAOIY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|