C23H27F2N7 — CID 111921247
1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]guanidine (PubChem CID 111921247) has the molecular formula C23H27F2N7 and a molecular weight of 439.51 g/mol. Its IUPAC name is 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111921247 |
| Molecular Formula | C23H27F2N7 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(Cn2cncn2)c1)NC1CCN(c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C23H27F2N7/c1-2-27-23(28-12-17-4-3-5-18(10-17)13-32-16-26-15-29-32)30-20-8-9-31(14-20)22-7-6-19(24)11-21(22)25/h3-7,10-11,15-16,20H,2,8-9,12-14H2,1H3,(H2,27,28,30) |
| InChIKey | JPECTFKJJQLQRS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|