C18H24F2IN5S — CID 111920924
1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[(4-methyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 111920924) has the molecular formula C18H24F2IN5S and a molecular weight of 507.39 g/mol. Its IUPAC name is 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[(4-methyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[(4-methyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111920924 |
| Molecular Formula | C18H24F2IN5S |
| Molecular Weight | 507.39 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[(4-methyl-1,3-thiazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1scnc1C)NC1CCN(c2ccc(F)cc2F)C1.I |
| InChI | InChI=1S/C18H23F2N5S.HI/c1-3-21-18(22-9-17-12(2)23-11-26-17)24-14-6-7-25(10-14)16-5-4-13(19)8-15(16)20;/h4-5,8,11,14H,3,6-7,9-10H2,1-2H3,(H2,21,22,24);1H |
| InChIKey | YJSYXVLGZMEXQG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|