C18H24F2N6 — CID 111920523
1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[(2-methylpyrazol-3-yl)methyl]guanidine (PubChem CID 111920523) has the molecular formula C18H24F2N6 and a molecular weight of 362.43 g/mol. Its IUPAC name is 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[(2-methylpyrazol-3-yl)methyl]guanidine.
| Compound Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[(2-methylpyrazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111920523 |
| Molecular Formula | C18H24F2N6 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[(2-methylpyrazol-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccnn1C)NC1CCN(c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C18H24F2N6/c1-3-21-18(22-11-15-6-8-23-25(15)2)24-14-7-9-26(12-14)17-5-4-13(19)10-16(17)20/h4-6,8,10,14H,3,7,9,11-12H2,1-2H3,(H2,21,22,24) |
| InChIKey | CGJRTOGBWQJYMF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|