C18H23F2N5O2S2 — CID 111920913
1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[(5-sulfamoylthiophen-2-yl)methyl]guanidine (PubChem CID 111920913) has the molecular formula C18H23F2N5O2S2 and a molecular weight of 443.55 g/mol. Its IUPAC name is 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[(5-sulfamoylthiophen-2-yl)methyl]guanidine.
| Compound Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[(5-sulfamoylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111920913 |
| Molecular Formula | C18H23F2N5O2S2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[(5-sulfamoylthiophen-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(S(N)(=O)=O)s1)NC1CCN(c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C18H23F2N5O2S2/c1-2-22-18(23-10-14-4-6-17(28-14)29(21,26)27)24-13-7-8-25(11-13)16-5-3-12(19)9-15(16)20/h3-6,9,13H,2,7-8,10-11H2,1H3,(H2,21,26,27)(H2,22,23,24) |
| InChIKey | SFACHJZBPNYLGW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|