C15H23F2IN4O — CID 111993944
1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-(2-hydroxyethyl)guanidine;hydroiodide (PubChem CID 111993944) has the molecular formula C15H23F2IN4O and a molecular weight of 440.28 g/mol. Its IUPAC name is 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-(2-hydroxyethyl)guanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-(2-hydroxyethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111993944 |
| Molecular Formula | C15H23F2IN4O |
| Molecular Weight | 440.28 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-(2-hydroxyethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCO)NC1CCN(c2ccc(F)cc2F)C1.I |
| InChI | InChI=1S/C15H22F2N4O.HI/c1-2-18-15(19-6-8-22)20-12-5-7-21(10-12)14-4-3-11(16)9-13(14)17;/h3-4,9,12,22H,2,5-8,10H2,1H3,(H2,18,19,20);1H |
| InChIKey | DPBVLHIXBWXZGJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|