C17H23F2N7 — CID 111920529
1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 111920529) has the molecular formula C17H23F2N7 and a molecular weight of 363.42 g/mol. Its IUPAC name is 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111920529 |
| Molecular Formula | C17H23F2N7 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1nncn1C)NC1CCN(c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C17H23F2N7/c1-3-20-17(21-9-16-24-22-11-25(16)2)23-13-6-7-26(10-13)15-5-4-12(18)8-14(15)19/h4-5,8,11,13H,3,6-7,9-10H2,1-2H3,(H2,20,21,23) |
| InChIKey | OLSFKZYNCKQTSP-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|