C18H27N7 — CID 111923601
1-ethyl-3-[1-(4-methylphenyl)pyrrolidin-3-yl]-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 111923601) has the molecular formula C18H27N7 and a molecular weight of 341.46 g/mol. Its IUPAC name is 1-ethyl-3-[1-(4-methylphenyl)pyrrolidin-3-yl]-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[1-(4-methylphenyl)pyrrolidin-3-yl]-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111923601 |
| Molecular Formula | C18H27N7 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.23 |
| IUPAC Name | 1-ethyl-3-[1-(4-methylphenyl)pyrrolidin-3-yl]-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1nncn1C)NC1CCN(c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C18H27N7/c1-4-19-18(20-11-17-23-21-13-24(17)3)22-15-9-10-25(12-15)16-7-5-14(2)6-8-16/h5-8,13,15H,4,9-12H2,1-3H3,(H2,19,20,22) |
| InChIKey | JNWUAKXPJUXKKT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|