C23H29F2N5O2 — CID 111920499
2-[4-[2-[[[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]ethyl]phenoxy]acetamide (PubChem CID 111920499) has the molecular formula C23H29F2N5O2 and a molecular weight of 445.51 g/mol. Its IUPAC name is 2-[4-[2-[[[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]ethyl]phenoxy]acetamide.
| Compound Name | 2-[4-[2-[[[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]ethyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 111920499 |
| Molecular Formula | C23H29F2N5O2 |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | 2-[4-[2-[[[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]ethyl]phenoxy]acetamide |
| SMILES | CCN/C(=N\CCc1ccc(OCC(N)=O)cc1)NC1CCN(c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C23H29F2N5O2/c1-2-27-23(28-11-9-16-3-6-19(7-4-16)32-15-22(26)31)29-18-10-12-30(14-18)21-8-5-17(24)13-20(21)25/h3-8,13,18H,2,9-12,14-15H2,1H3,(H2,26,31)(H2,27,28,29) |
| InChIKey | PEHWAVVDAXEFKS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|