C22H33F2N5O — CID 111920665
1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[3-(2-oxopyrrolidin-1-yl)pentyl]guanidine (PubChem CID 111920665) has the molecular formula C22H33F2N5O and a molecular weight of 421.54 g/mol. Its IUPAC name is 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[3-(2-oxopyrrolidin-1-yl)pentyl]guanidine.
| Compound Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[3-(2-oxopyrrolidin-1-yl)pentyl]guanidine |
|---|---|
| PubChem CID | 111920665 |
| Molecular Formula | C22H33F2N5O |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[3-(2-oxopyrrolidin-1-yl)pentyl]guanidine |
| SMILES | CCN/C(=N\CCC(CC)N1CCCC1=O)NC1CCN(c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C22H33F2N5O/c1-3-18(29-12-5-6-21(29)30)9-11-26-22(25-4-2)27-17-10-13-28(15-17)20-8-7-16(23)14-19(20)24/h7-8,14,17-18H,3-6,9-13,15H2,1-2H3,(H2,25,26,27) |
| InChIKey | JSWACSXSENFSJW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|