C22H30ClN5O2 — CID 109463476
1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]guanidine (PubChem CID 109463476) has the molecular formula C22H30ClN5O2 and a molecular weight of 431.97 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 109463476 |
| Molecular Formula | C22H30ClN5O2 |
| Molecular Weight | 431.97 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-ethyl-2-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(OCCOC)nc1)NC1CCN(c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C22H30ClN5O2/c1-3-24-22(26-15-17-7-8-21(25-14-17)30-12-11-29-2)27-19-9-10-28(16-19)20-6-4-5-18(23)13-20/h4-8,13-14,19H,3,9-12,15-16H2,1-2H3,(H2,24,26,27) |
| InChIKey | WSRROWSFFHOCNW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.97 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|