C19H23Cl2N5 — CID 109463420
1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-[(6-chloro-3-pyridinyl)methyl]-3-ethylguanidine (PubChem CID 109463420) has the molecular formula C19H23Cl2N5 and a molecular weight of 392.33 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-[(6-chloro-3-pyridinyl)methyl]-3-ethylguanidine.
| Compound Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-[(6-chloro-3-pyridinyl)methyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 109463420 |
| Molecular Formula | C19H23Cl2N5 |
| Molecular Weight | 392.33 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-[(6-chloro-3-pyridinyl)methyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1ccc(Cl)nc1)NC1CCN(c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C19H23Cl2N5/c1-2-22-19(24-12-14-6-7-18(21)23-11-14)25-16-8-9-26(13-16)17-5-3-4-15(20)10-17/h3-7,10-11,16H,2,8-9,12-13H2,1H3,(H2,22,24,25) |
| InChIKey | AWBMLZOPYZAZJL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|