C19H27BrIN7 — CID 111918098
1-[1-(4-bromophenyl)pyrrolidin-3-yl]-2-methyl-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111918098) has the molecular formula C19H27BrIN7 and a molecular weight of 560.28 g/mol. Its IUPAC name is 1-[1-(4-bromophenyl)pyrrolidin-3-yl]-2-methyl-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[1-(4-bromophenyl)pyrrolidin-3-yl]-2-methyl-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111918098 |
| Molecular Formula | C19H27BrIN7 |
| Molecular Weight | 560.28 g/mol |
| Exact Mass | 559.06 |
| IUPAC Name | 1-[1-(4-bromophenyl)pyrrolidin-3-yl]-2-methyl-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1nnc2n1CCCC2)NC1CCN(c2ccc(Br)cc2)C1.I |
| InChI | InChI=1S/C19H26BrN7.HI/c1-21-19(22-12-18-25-24-17-4-2-3-10-27(17)18)23-15-9-11-26(13-15)16-7-5-14(20)6-8-16;/h5-8,15H,2-4,9-13H2,1H3,(H2,21,22,23);1H |
| InChIKey | FGBDOVRXWCRXRX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|