C18H22BrClIN5 — CID 111918096
1-[1-(4-bromophenyl)pyrrolidin-3-yl]-3-[(6-chloro-3-pyridinyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111918096) has the molecular formula C18H22BrClIN5 and a molecular weight of 550.67 g/mol. Its IUPAC name is 1-[1-(4-bromophenyl)pyrrolidin-3-yl]-3-[(6-chloro-3-pyridinyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[1-(4-bromophenyl)pyrrolidin-3-yl]-3-[(6-chloro-3-pyridinyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111918096 |
| Molecular Formula | C18H22BrClIN5 |
| Molecular Weight | 550.67 g/mol |
| Exact Mass | 548.98 |
| IUPAC Name | 1-[1-(4-bromophenyl)pyrrolidin-3-yl]-3-[(6-chloro-3-pyridinyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(Cl)nc1)NC1CCN(c2ccc(Br)cc2)C1.I |
| InChI | InChI=1S/C18H21BrClN5.HI/c1-21-18(23-11-13-2-7-17(20)22-10-13)24-15-8-9-25(12-15)16-5-3-14(19)4-6-16;/h2-7,10,15H,8-9,11-12H2,1H3,(H2,21,23,24);1H |
| InChIKey | HNAYEOIVGXSLGY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.67 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|