C16H23BrN4 — CID 119153985
1-[1-(4-bromophenyl)pyrrolidin-3-yl]-3-cyclobutyl-2-methylguanidine (PubChem CID 119153985) has the molecular formula C16H23BrN4 and a molecular weight of 351.29 g/mol. Its IUPAC name is 1-[1-(4-bromophenyl)pyrrolidin-3-yl]-3-cyclobutyl-2-methylguanidine.
| Compound Name | 1-[1-(4-bromophenyl)pyrrolidin-3-yl]-3-cyclobutyl-2-methylguanidine |
|---|---|
| PubChem CID | 119153985 |
| Molecular Formula | C16H23BrN4 |
| Molecular Weight | 351.29 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 1-[1-(4-bromophenyl)pyrrolidin-3-yl]-3-cyclobutyl-2-methylguanidine |
| SMILES | C/N=C(\NC1CCC1)NC1CCN(c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C16H23BrN4/c1-18-16(19-13-3-2-4-13)20-14-9-10-21(11-14)15-7-5-12(17)6-8-15/h5-8,13-14H,2-4,9-11H2,1H3,(H2,18,19,20) |
| InChIKey | VTLLMYYXPNBIDD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|