C19H30BrN5O2 — CID 111918093
tert-butyl N-[2-[[N-[1-(4-bromophenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate (PubChem CID 111918093) has the molecular formula C19H30BrN5O2 and a molecular weight of 440.39 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-[1-(4-bromophenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[N-[1-(4-bromophenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 111918093 |
| Molecular Formula | C19H30BrN5O2 |
| Molecular Weight | 440.39 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | tert-butyl N-[2-[[N-[1-(4-bromophenyl)pyrrolidin-3-yl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate |
| SMILES | C/N=C(\NCCNC(=O)OC(C)(C)C)NC1CCN(c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C19H30BrN5O2/c1-19(2,3)27-18(26)23-11-10-22-17(21-4)24-15-9-12-25(13-15)16-7-5-14(20)6-8-16/h5-8,15H,9-13H2,1-4H3,(H,23,26)(H2,21,22,24) |
| InChIKey | IEXKTGAUHLHYIF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|