C17H28BrIN4O2 — CID 111917752
1-[1-(4-bromophenyl)pyrrolidin-3-yl]-3-[2-(2-methoxyethoxy)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111917752) has the molecular formula C17H28BrIN4O2 and a molecular weight of 527.25 g/mol. Its IUPAC name is 1-[1-(4-bromophenyl)pyrrolidin-3-yl]-3-[2-(2-methoxyethoxy)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[1-(4-bromophenyl)pyrrolidin-3-yl]-3-[2-(2-methoxyethoxy)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111917752 |
| Molecular Formula | C17H28BrIN4O2 |
| Molecular Weight | 527.25 g/mol |
| Exact Mass | 526.04 |
| IUPAC Name | 1-[1-(4-bromophenyl)pyrrolidin-3-yl]-3-[2-(2-methoxyethoxy)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCOCCOC)NC1CCN(c2ccc(Br)cc2)C1.I |
| InChI | InChI=1S/C17H27BrN4O2.HI/c1-19-17(20-8-10-24-12-11-23-2)21-15-7-9-22(13-15)16-5-3-14(18)4-6-16;/h3-6,15H,7-13H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | PTHAQPWFRHOAKZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|