C19H31BrN4O2 — CID 111922711
1-[1-(2-bromophenyl)pyrrolidin-3-yl]-3-[4-(2-methoxyethoxy)butyl]-2-methylguanidine (PubChem CID 111922711) has the molecular formula C19H31BrN4O2 and a molecular weight of 427.39 g/mol. Its IUPAC name is 1-[1-(2-bromophenyl)pyrrolidin-3-yl]-3-[4-(2-methoxyethoxy)butyl]-2-methylguanidine.
| Compound Name | 1-[1-(2-bromophenyl)pyrrolidin-3-yl]-3-[4-(2-methoxyethoxy)butyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111922711 |
| Molecular Formula | C19H31BrN4O2 |
| Molecular Weight | 427.39 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 1-[1-(2-bromophenyl)pyrrolidin-3-yl]-3-[4-(2-methoxyethoxy)butyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCCCOCCOC)NC1CCN(c2ccccc2Br)C1 |
| InChI | InChI=1S/C19H31BrN4O2/c1-21-19(22-10-5-6-12-26-14-13-25-2)23-16-9-11-24(15-16)18-8-4-3-7-17(18)20/h3-4,7-8,16H,5-6,9-15H2,1-2H3,(H2,21,22,23) |
| InChIKey | ZWYZKAIZSPBQEX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|