C14H20BrN3O2 — CID 96523423
1-[(3R)-1-(2-bromophenyl)pyrrolidin-3-yl]-3-(2-methoxyethyl)urea (PubChem CID 96523423) has the molecular formula C14H20BrN3O2 and a molecular weight of 342.24 g/mol. Its IUPAC name is 1-[(3R)-1-(2-bromophenyl)pyrrolidin-3-yl]-3-(2-methoxyethyl)urea.
| Compound Name | 1-[(3R)-1-(2-bromophenyl)pyrrolidin-3-yl]-3-(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 96523423 |
| Molecular Formula | C14H20BrN3O2 |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 1-[(3R)-1-(2-bromophenyl)pyrrolidin-3-yl]-3-(2-methoxyethyl)urea |
| SMILES | COCCNC(=O)N[C@@H]1CCN(c2ccccc2Br)C1 |
| InChI | InChI=1S/C14H20BrN3O2/c1-20-9-7-16-14(19)17-11-6-8-18(10-11)13-5-3-2-4-12(13)15/h2-5,11H,6-10H2,1H3,(H2,16,17,19)/t11-/m1/s1 |
| InChIKey | DICZIDXDHBDHNP-LLVKDONJSA-N |
| XLogP | 1.97 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|